C18H27Cl2N3OS — CID 111515126
1-[1-(2,4-dichlorophenyl)ethyl]-3-ethyl-2-[(4-methylsulfanyloxan-4-yl)methyl]guanidine (PubChem CID 111515126) has the molecular formula C18H27Cl2N3OS and a molecular weight of 404.41 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-3-ethyl-2-[(4-methylsulfanyloxan-4-yl)methyl]guanidine.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-3-ethyl-2-[(4-methylsulfanyloxan-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111515126 |
| Molecular Formula | C18H27Cl2N3OS |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-3-ethyl-2-[(4-methylsulfanyloxan-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC1(SC)CCOCC1)NC(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H27Cl2N3OS/c1-4-21-17(22-12-18(25-3)7-9-24-10-8-18)23-13(2)15-6-5-14(19)11-16(15)20/h5-6,11,13H,4,7-10,12H2,1-3H3,(H2,21,22,23) |
| InChIKey | FGNTZRYMDNIZID-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|