C21H27Cl2N5O — CID 111310536
1-[1-(2,4-dichlorophenyl)ethyl]-3-ethyl-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine (PubChem CID 111310536) has the molecular formula C21H27Cl2N5O and a molecular weight of 436.39 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-3-ethyl-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-3-ethyl-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111310536 |
| Molecular Formula | C21H27Cl2N5O |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-3-ethyl-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCOCC1)NC(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H27Cl2N5O/c1-3-24-21(27-15(2)18-7-6-17(22)13-19(18)23)26-14-16-5-4-8-25-20(16)28-9-11-29-12-10-28/h4-8,13,15H,3,9-12,14H2,1-2H3,(H2,24,26,27) |
| InChIKey | WYOYJKBMHJPUTL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|