C22H30Cl2N6 — CID 111310120
1-[1-(2,4-dichlorophenyl)ethyl]-3-ethyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine (PubChem CID 111310120) has the molecular formula C22H30Cl2N6 and a molecular weight of 449.43 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-3-ethyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-3-ethyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111310120 |
| Molecular Formula | C22H30Cl2N6 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-3-ethyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCN(C)CC1)NC(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H30Cl2N6/c1-4-25-22(28-16(2)19-8-7-18(23)14-20(19)24)27-15-17-6-5-9-26-21(17)30-12-10-29(3)11-13-30/h5-9,14,16H,4,10-13,15H2,1-3H3,(H2,25,27,28) |
| InChIKey | JTGGVEXBXNNSBX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|