C23H43N7 — CID 110998329
1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine (PubChem CID 110998329) has the molecular formula C23H43N7 and a molecular weight of 417.65 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 110998329 |
| Molecular Formula | C23H43N7 |
| Molecular Weight | 417.65 g/mol |
| Exact Mass | 417.36 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-3-ethyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCN(C)CC1)NC(C)CCCN(CC)CC |
| InChI | InChI=1S/C23H43N7/c1-6-24-23(27-20(4)11-10-14-29(7-2)8-3)26-19-21-12-9-13-25-22(21)30-17-15-28(5)16-18-30/h9,12-13,20H,6-8,10-11,14-19H2,1-5H3,(H2,24,26,27) |
| InChIKey | TWFLPMJVIQRUSQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 59.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.65 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|