C20H35N5O3 — CID 111516193
ethyl 4-[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111516193) has the molecular formula C20H35N5O3 and a molecular weight of 393.53 g/mol. Its IUPAC name is ethyl 4-[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111516193 |
| Molecular Formula | C20H35N5O3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | ethyl 4-[[N-ethyl-N'-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\Cc1cc(C(CC)CC)no1)NC1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C20H35N5O3/c1-5-15(6-2)18-13-17(28-24-18)14-22-19(21-7-3)23-16-9-11-25(12-10-16)20(26)27-8-4/h13,15-16H,5-12,14H2,1-4H3,(H2,21,22,23) |
| InChIKey | VUYQBCOZKOPTGG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|