C16H25IN4S2 — CID 111518228
3-ethyl-2-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-1-methyl-1-(thiophen-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111518228) has the molecular formula C16H25IN4S2 and a molecular weight of 464.44 g/mol. Its IUPAC name is 3-ethyl-2-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-1-methyl-1-(thiophen-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 3-ethyl-2-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-1-methyl-1-(thiophen-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111518228 |
| Molecular Formula | C16H25IN4S2 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | 3-ethyl-2-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-1-methyl-1-(thiophen-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1ncc(CC)s1)N(C)Cc1ccsc1.I |
| InChI | InChI=1S/C16H24N4S2.HI/c1-4-14-10-19-15(22-14)6-8-18-16(17-5-2)20(3)11-13-7-9-21-12-13;/h7,9-10,12H,4-6,8,11H2,1-3H3,(H,17,18);1H |
| InChIKey | ZYGNIEJOCNHGHP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|