C19H35N5S — CID 111522196
1-ethyl-3-(3-ethyl-2-pyrrolidin-1-ylpentyl)-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine (PubChem CID 111522196) has the molecular formula C19H35N5S and a molecular weight of 365.59 g/mol. Its IUPAC name is 1-ethyl-3-(3-ethyl-2-pyrrolidin-1-ylpentyl)-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-(3-ethyl-2-pyrrolidin-1-ylpentyl)-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111522196 |
| Molecular Formula | C19H35N5S |
| Molecular Weight | 365.59 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | 1-ethyl-3-(3-ethyl-2-pyrrolidin-1-ylpentyl)-2-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ncc(C)s1)NCC(C(CC)CC)N1CCCC1 |
| InChI | InChI=1S/C19H35N5S/c1-5-16(6-2)17(24-10-8-9-11-24)13-22-19(20-7-3)23-14-18-21-12-15(4)25-18/h12,16-17H,5-11,13-14H2,1-4H3,(H2,20,22,23) |
| InChIKey | UKBYGMLYVGEOGR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.59 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|