C21H32N2O3 — CID 11152617
(E,4R,6R)-4-benzyl-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2,4,6-tetramethyl-1,3-dioxan-5-imine (PubChem CID 11152617) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is (E,4R,6R)-4-benzyl-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2,4,6-tetramethyl-1,3-dioxan-5-imine.
| Compound Name | (E,4R,6R)-4-benzyl-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2,4,6-tetramethyl-1,3-dioxan-5-imine |
|---|---|
| PubChem CID | 11152617 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | (E,4R,6R)-4-benzyl-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2,4,6-tetramethyl-1,3-dioxan-5-imine |
| SMILES | COC[C@H]1CCCN1/N=C1\[C@@H](C)OC(C)(C)O[C@]1(C)Cc1ccccc1 |
| InChI | InChI=1S/C21H32N2O3/c1-16-19(22-23-13-9-12-18(23)15-24-5)21(4,26-20(2,3)25-16)14-17-10-7-6-8-11-17/h6-8,10-11,16,18H,9,12-15H2,1-5H3/b22-19+/t16-,18-,21-/m1/s1 |
| InChIKey | QDQPZDFIKRQNQN-SKDIRNKISA-N |
| XLogP | 3.63 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|