C15H26N6S — CID 111528129
2-methyl-1-(3-methylsulfanylcyclopentyl)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111528129) has the molecular formula C15H26N6S and a molecular weight of 322.48 g/mol. Its IUPAC name is 2-methyl-1-(3-methylsulfanylcyclopentyl)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 2-methyl-1-(3-methylsulfanylcyclopentyl)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111528129 |
| Molecular Formula | C15H26N6S |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 2-methyl-1-(3-methylsulfanylcyclopentyl)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | C/N=C(\NCc1nnc2n1CCCC2)NC1CCC(SC)C1 |
| InChI | InChI=1S/C15H26N6S/c1-16-15(18-11-6-7-12(9-11)22-2)17-10-14-20-19-13-5-3-4-8-21(13)14/h11-12H,3-10H2,1-2H3,(H2,16,17,18) |
| InChIKey | LSEXONNZCFVRHE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|