C20H40O2Si2 — CID 11152863
tert-butyl-[(1R,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethynyl-2-methylpent-4-enoxy]-dimethylsilane (PubChem CID 11152863) has the molecular formula C20H40O2Si2 and a molecular weight of 368.71 g/mol. Its IUPAC name is tert-butyl-[(1R,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethynyl-2-methylpent-4-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1R,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethynyl-2-methylpent-4-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11152863 |
| Molecular Formula | C20H40O2Si2 |
| Molecular Weight | 368.71 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | tert-butyl-[(1R,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethynyl-2-methylpent-4-enoxy]-dimethylsilane |
| SMILES | C#C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O2Si2/c1-14-17(21-23(10,11)19(4,5)6)16(3)18(15-2)22-24(12,13)20(7,8)9/h1,15-18H,2H2,3-13H3/t16-,17+,18-/m1/s1 |
| InChIKey | KYALRZBFVNOUNA-FGTMMUONSA-N |
| XLogP | 6.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.71 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|