C16H26F3N5S — CID 111533075
1-ethyl-2-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111533075) has the molecular formula C16H26F3N5S and a molecular weight of 377.48 g/mol. Its IUPAC name is 1-ethyl-2-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 1-ethyl-2-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111533075 |
| Molecular Formula | C16H26F3N5S |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 1-ethyl-2-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | CCN/C(=N\CCc1ncc(CC)s1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C16H26F3N5S/c1-3-13-9-22-14(25-13)5-7-21-15(20-4-2)23-12-6-8-24(10-12)11-16(17,18)19/h9,12H,3-8,10-11H2,1-2H3,(H2,20,21,23) |
| InChIKey | WOVGNQYVBALRSD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|