C16H27F3N6 — CID 111914812
1-ethyl-2-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111914812) has the molecular formula C16H27F3N6 and a molecular weight of 360.43 g/mol. Its IUPAC name is 1-ethyl-2-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 1-ethyl-2-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111914812 |
| Molecular Formula | C16H27F3N6 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 1-ethyl-2-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | CCN/C(=N\CCCc1cn[nH]c1C)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C16H27F3N6/c1-3-20-15(21-7-4-5-13-9-22-24-12(13)2)23-14-6-8-25(10-14)11-16(17,18)19/h9,14H,3-8,10-11H2,1-2H3,(H,22,24)(H2,20,21,23) |
| InChIKey | MTCMLGGYFUOICA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|