C22H37NO4Si — CID 11154031
(1R,5S,8S,9S)-2-benzyl-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,6-dimethyl-3,7-dioxa-2-azabicyclo[3.3.1]nonan-9-ol (PubChem CID 11154031) has the molecular formula C22H37NO4Si and a molecular weight of 407.63 g/mol. Its IUPAC name is (1R,5S,8S,9S)-2-benzyl-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,6-dimethyl-3,7-dioxa-2-azabicyclo[3.3.1]nonan-9-ol.
| Compound Name | (1R,5S,8S,9S)-2-benzyl-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,6-dimethyl-3,7-dioxa-2-azabicyclo[3.3.1]nonan-9-ol |
|---|---|
| PubChem CID | 11154031 |
| Molecular Formula | C22H37NO4Si |
| Molecular Weight | 407.63 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | (1R,5S,8S,9S)-2-benzyl-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,6-dimethyl-3,7-dioxa-2-azabicyclo[3.3.1]nonan-9-ol |
| SMILES | CC1(C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]2[C@@H](O)[C@@H]1CON2Cc1ccccc1 |
| InChI | InChI=1S/C22H37NO4Si/c1-21(2,3)28(6,7)26-15-18-19-20(24)17(22(4,5)27-18)14-25-23(19)13-16-11-9-8-10-12-16/h8-12,17-20,24H,13-15H2,1-7H3/t17-,18+,19-,20-/m0/s1 |
| InChIKey | AAACKBBWLACGEE-YRPNKDGESA-N |
| XLogP | 3.98 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.63 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|