C22H39NO4Si — CID 101374560
(3R,4R,5S,6S)-5-(benzylamino)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(hydroxymethyl)-2,2-dimethyloxan-4-ol (PubChem CID 101374560) has the molecular formula C22H39NO4Si and a molecular weight of 409.64 g/mol. Its IUPAC name is (3R,4R,5S,6S)-5-(benzylamino)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(hydroxymethyl)-2,2-dimethyloxan-4-ol.
| Compound Name | (3R,4R,5S,6S)-5-(benzylamino)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(hydroxymethyl)-2,2-dimethyloxan-4-ol |
|---|---|
| PubChem CID | 101374560 |
| Molecular Formula | C22H39NO4Si |
| Molecular Weight | 409.64 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | (3R,4R,5S,6S)-5-(benzylamino)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(hydroxymethyl)-2,2-dimethyloxan-4-ol |
| SMILES | CC1(C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](NCc2ccccc2)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C22H39NO4Si/c1-21(2,3)28(6,7)26-15-18-19(23-13-16-11-9-8-10-12-16)20(25)17(14-24)22(4,5)27-18/h8-12,17-20,23-25H,13-15H2,1-7H3/t17-,18-,19-,20-/m1/s1 |
| InChIKey | FEIIRMRPPVCAQO-UAFMIMERSA-N |
| XLogP | 3.31 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.64 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|