C23H41NO5Si — CID 102276966
(4R,5S)-N-benzyl-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethoxyethyl]-2,2-dimethyl-1,3-dioxan-5-amine (PubChem CID 102276966) has the molecular formula C23H41NO5Si and a molecular weight of 439.67 g/mol. Its IUPAC name is (4R,5S)-N-benzyl-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethoxyethyl]-2,2-dimethyl-1,3-dioxan-5-amine.
| Compound Name | (4R,5S)-N-benzyl-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethoxyethyl]-2,2-dimethyl-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 102276966 |
| Molecular Formula | C23H41NO5Si |
| Molecular Weight | 439.67 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | (4R,5S)-N-benzyl-4-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethoxyethyl]-2,2-dimethyl-1,3-dioxan-5-amine |
| SMILES | COC(OC)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)OC[C@@H]1NCc1ccccc1 |
| InChI | InChI=1S/C23H41NO5Si/c1-22(2,3)30(8,9)29-20(21(25-6)26-7)19-18(16-27-23(4,5)28-19)24-15-17-13-11-10-12-14-17/h10-14,18-21,24H,15-16H2,1-9H3/t18-,19+,20+/m0/s1 |
| InChIKey | ULSVISRQJAMYLQ-XUVXKRRUSA-N |
| XLogP | 4.31 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.67 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|