C23H41NO4Si — CID 144753194
1-[4-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methoxy-2-methylmorpholin-2-yl]propan-2-ol (PubChem CID 144753194) has the molecular formula C23H41NO4Si and a molecular weight of 423.67 g/mol. Its IUPAC name is 1-[4-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methoxy-2-methylmorpholin-2-yl]propan-2-ol.
| Compound Name | 1-[4-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methoxy-2-methylmorpholin-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 144753194 |
| Molecular Formula | C23H41NO4Si |
| Molecular Weight | 423.67 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | 1-[4-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methoxy-2-methylmorpholin-2-yl]propan-2-ol |
| SMILES | COC1N(Cc2ccccc2)C(CO[Si](C)(C)C(C)(C)C)COC1(C)CC(C)O |
| InChI | InChI=1S/C23H41NO4Si/c1-18(25)14-23(5)21(26-6)24(15-19-12-10-9-11-13-19)20(16-27-23)17-28-29(7,8)22(2,3)4/h9-13,18,20-21,25H,14-17H2,1-8H3 |
| InChIKey | GBNIUTUSVADYGE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.67 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|