C22H29N5O4 — CID 111541420
N-(2-methoxyethyl)-4-(4-methoxyphenyl)-N'-[(4-nitrophenyl)methyl]piperazine-1-carboximidamide (PubChem CID 111541420) has the molecular formula C22H29N5O4 and a molecular weight of 427.51 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-(4-methoxyphenyl)-N'-[(4-nitrophenyl)methyl]piperazine-1-carboximidamide.
| Compound Name | N-(2-methoxyethyl)-4-(4-methoxyphenyl)-N'-[(4-nitrophenyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111541420 |
| Molecular Formula | C22H29N5O4 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | N-(2-methoxyethyl)-4-(4-methoxyphenyl)-N'-[(4-nitrophenyl)methyl]piperazine-1-carboximidamide |
| SMILES | COCCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)N1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C22H29N5O4/c1-30-16-11-23-22(24-17-18-3-5-20(6-4-18)27(28)29)26-14-12-25(13-15-26)19-7-9-21(31-2)10-8-19/h3-10H,11-17H2,1-2H3,(H,23,24) |
| InChIKey | HHVWVOYEXVBFIU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|