C21H27IN6O3 — CID 111541771
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(furan-2-ylmethyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 111541771) has the molecular formula C21H27IN6O3 and a molecular weight of 538.39 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(furan-2-ylmethyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(furan-2-ylmethyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111541771 |
| Molecular Formula | C21H27IN6O3 |
| Molecular Weight | 538.39 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-(furan-2-ylmethyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | Cc1cc(C)n(CCCN/C(=N\Cc2ccc([N+](=O)[O-])cc2)NCc2ccco2)n1.I |
| InChI | InChI=1S/C21H26N6O3.HI/c1-16-13-17(2)26(25-16)11-4-10-22-21(24-15-20-5-3-12-30-20)23-14-18-6-8-19(9-7-18)27(28)29;/h3,5-9,12-13H,4,10-11,14-15H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | BNIFYQOAYOKIAQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|