C24H26N4O3 — CID 11154316
7-[4-(2-cyanoethylamino)-3,3a,4,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylic acid (PubChem CID 11154316) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is 7-[4-(2-cyanoethylamino)-3,3a,4,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-[4-(2-cyanoethylamino)-3,3a,4,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 11154316 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 7-[4-(2-cyanoethylamino)-3,3a,4,6a-tetrahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylic acid |
| SMILES | Cc1c(N2CC3C=CC(NCCC#N)C3C2)ccc2c(=O)c(C(=O)O)cn(C3CC3)c12 |
| InChI | InChI=1S/C24H26N4O3/c1-14-21(27-11-15-3-7-20(18(15)12-27)26-10-2-9-25)8-6-17-22(14)28(16-4-5-16)13-19(23(17)29)24(30)31/h3,6-8,13,15-16,18,20,26H,2,4-5,10-12H2,1H3,(H,30,31) |
| InChIKey | YIMKMCOAILRLII-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|