C21H33NO4Si2 — CID 11154349
methyl (2S,4S,11R)-10-oxo-8-trimethylsilyl-4-(4-trimethylsilylbut-3-ynyl)-9-oxa-1-azatricyclo[5.3.1.04,11]undec-7-ene-2-carboxylate (PubChem CID 11154349) has the molecular formula C21H33NO4Si2 and a molecular weight of 419.67 g/mol. Its IUPAC name is methyl (2S,4S,11R)-10-oxo-8-trimethylsilyl-4-(4-trimethylsilylbut-3-ynyl)-9-oxa-1-azatricyclo[5.3.1.04,11]undec-7-ene-2-carboxylate.
| Compound Name | methyl (2S,4S,11R)-10-oxo-8-trimethylsilyl-4-(4-trimethylsilylbut-3-ynyl)-9-oxa-1-azatricyclo[5.3.1.04,11]undec-7-ene-2-carboxylate |
|---|---|
| PubChem CID | 11154349 |
| Molecular Formula | C21H33NO4Si2 |
| Molecular Weight | 419.67 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | methyl (2S,4S,11R)-10-oxo-8-trimethylsilyl-4-(4-trimethylsilylbut-3-ynyl)-9-oxa-1-azatricyclo[5.3.1.04,11]undec-7-ene-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@]2(CCC#C[Si](C)(C)C)CCC3=C([Si](C)(C)C)OC(=O)N1[C@@H]32 |
| InChI | InChI=1S/C21H33NO4Si2/c1-25-18(23)16-14-21(11-8-9-13-27(2,3)4)12-10-15-17(21)22(16)20(24)26-19(15)28(5,6)7/h16-17H,8,10-12,14H2,1-7H3/t16-,17-,21-/m0/s1 |
| InChIKey | FJYDCMFWDJVNAU-FIKGOQFSSA-N |
| XLogP | 4.33 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.67 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|