C19H27NO4Si — CID 11175877
methyl (2S,4R,11R)-8-methyl-10-oxo-4-(4-trimethylsilylbut-3-ynyl)-9-oxa-1-azatricyclo[5.3.1.04,11]undec-7-ene-2-carboxylate (PubChem CID 11175877) has the molecular formula C19H27NO4Si and a molecular weight of 361.51 g/mol. Its IUPAC name is methyl (2S,4R,11R)-8-methyl-10-oxo-4-(4-trimethylsilylbut-3-ynyl)-9-oxa-1-azatricyclo[5.3.1.04,11]undec-7-ene-2-carboxylate.
| Compound Name | methyl (2S,4R,11R)-8-methyl-10-oxo-4-(4-trimethylsilylbut-3-ynyl)-9-oxa-1-azatricyclo[5.3.1.04,11]undec-7-ene-2-carboxylate |
|---|---|
| PubChem CID | 11175877 |
| Molecular Formula | C19H27NO4Si |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | methyl (2S,4R,11R)-8-methyl-10-oxo-4-(4-trimethylsilylbut-3-ynyl)-9-oxa-1-azatricyclo[5.3.1.04,11]undec-7-ene-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@]2(CCC#C[Si](C)(C)C)CCC3=C(C)OC(=O)N1[C@@H]32 |
| InChI | InChI=1S/C19H27NO4Si/c1-13-14-8-10-19(9-6-7-11-25(3,4)5)12-15(17(21)23-2)20(16(14)19)18(22)24-13/h15-16H,6,8-10,12H2,1-5H3/t15-,16-,19-/m0/s1 |
| InChIKey | OLGMCOHTFTXYFD-BXWFABGCSA-N |
| XLogP | 3.47 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|