C19H29F3N4O2S — CID 111559980
1-[2-(2,4-dimethylphenyl)ethyl]-2-methyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine (PubChem CID 111559980) has the molecular formula C19H29F3N4O2S and a molecular weight of 434.53 g/mol. Its IUPAC name is 1-[2-(2,4-dimethylphenyl)ethyl]-2-methyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine.
| Compound Name | 1-[2-(2,4-dimethylphenyl)ethyl]-2-methyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111559980 |
| Molecular Formula | C19H29F3N4O2S |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 1-[2-(2,4-dimethylphenyl)ethyl]-2-methyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
| SMILES | C/N=C(\NCCc1ccc(C)cc1C)NCC1CCN(S(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H29F3N4O2S/c1-14-4-5-17(15(2)12-14)6-9-24-18(23-3)25-13-16-7-10-26(11-8-16)29(27,28)19(20,21)22/h4-5,12,16H,6-11,13H2,1-3H3,(H2,23,24,25) |
| InChIKey | LMERNBUULPMTDR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|