C12H20N4O3 — CID 111566577
1-(2-hydroxyethyl)-3-[1-(5-methyl-1,2,4-oxadiazol-3-yl)propyl]-1-prop-2-enylurea (PubChem CID 111566577) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[1-(5-methyl-1,2,4-oxadiazol-3-yl)propyl]-1-prop-2-enylurea.
| Compound Name | 1-(2-hydroxyethyl)-3-[1-(5-methyl-1,2,4-oxadiazol-3-yl)propyl]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 111566577 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[1-(5-methyl-1,2,4-oxadiazol-3-yl)propyl]-1-prop-2-enylurea |
| SMILES | C=CCN(CCO)C(=O)NC(CC)c1noc(C)n1 |
| InChI | InChI=1S/C12H20N4O3/c1-4-6-16(7-8-17)12(18)14-10(5-2)11-13-9(3)19-15-11/h4,10,17H,1,5-8H2,2-3H3,(H,14,18) |
| InChIKey | BKXMSDRSEGXNKD-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|