C22H32IN5O2 — CID 111571588
1-[[[N-ethyl-N'-[(5-phenyl-1,2-oxazol-3-yl)methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide (PubChem CID 111571588) has the molecular formula C22H32IN5O2 and a molecular weight of 525.44 g/mol. Its IUPAC name is 1-[[[N-ethyl-N'-[(5-phenyl-1,2-oxazol-3-yl)methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide.
| Compound Name | 1-[[[N-ethyl-N'-[(5-phenyl-1,2-oxazol-3-yl)methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111571588 |
| Molecular Formula | C22H32IN5O2 |
| Molecular Weight | 525.44 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | 1-[[[N-ethyl-N'-[(5-phenyl-1,2-oxazol-3-yl)methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(-c2ccccc2)on1)NCC1(C(=O)N(C)C)CCCC1.I |
| InChI | InChI=1S/C22H31N5O2.HI/c1-4-23-21(25-16-22(12-8-9-13-22)20(28)27(2)3)24-15-18-14-19(29-26-18)17-10-6-5-7-11-17;/h5-7,10-11,14H,4,8-9,12-13,15-16H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | BOPSHFOSIXGGKX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|