C20H29N5O2S — CID 111571965
1-[[[N-ethyl-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide (PubChem CID 111571965) has the molecular formula C20H29N5O2S and a molecular weight of 403.55 g/mol. Its IUPAC name is 1-[[[N-ethyl-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide.
| Compound Name | 1-[[[N-ethyl-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 111571965 |
| Molecular Formula | C20H29N5O2S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 1-[[[N-ethyl-N'-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide |
| SMILES | CCN/C(=N\Cc1coc(-c2cccs2)n1)NCC1(C(=O)N(C)C)CCCC1 |
| InChI | InChI=1S/C20H29N5O2S/c1-4-21-19(23-14-20(9-5-6-10-20)18(26)25(2)3)22-12-15-13-27-17(24-15)16-8-7-11-28-16/h7-8,11,13H,4-6,9-10,12,14H2,1-3H3,(H2,21,22,23) |
| InChIKey | PWMIBPCOJSWYGS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|