C38H50O6Si — CID 11157935
ethyl 4-[(2R,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]oxan-2-yl]-3-oxobutanoate (PubChem CID 11157935) has the molecular formula C38H50O6Si and a molecular weight of 630.90 g/mol. Its IUPAC name is ethyl 4-[(2R,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]oxan-2-yl]-3-oxobutanoate.
| Compound Name | ethyl 4-[(2R,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]oxan-2-yl]-3-oxobutanoate |
|---|---|
| PubChem CID | 11157935 |
| Molecular Formula | C38H50O6Si |
| Molecular Weight | 630.90 g/mol |
| Exact Mass | 630.34 |
| IUPAC Name | ethyl 4-[(2R,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]oxan-2-yl]-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)C[C@H]1CCC[C@@H](C[C@H](CCOCc2ccccc2)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C38H50O6Si/c1-5-42-37(40)27-31(39)26-32-18-15-19-33(43-32)28-34(24-25-41-29-30-16-9-6-10-17-30)44-45(38(2,3)4,35-20-11-7-12-21-35)36-22-13-8-14-23-36/h6-14,16-17,20-23,32-34H,5,15,18-19,24-29H2,1-4H3/t32-,33+,34+/m1/s1 |
| InChIKey | MAVUTTDNCBJJLA-WKNISULPSA-N |
| XLogP | 6.78 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.90 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|