C18H25N3O3S — CID 111582244
methyl 2-methyl-5-[[[N'-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)carbamimidoyl]amino]methyl]furan-3-carboxylate (PubChem CID 111582244) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is methyl 2-methyl-5-[[[N'-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)carbamimidoyl]amino]methyl]furan-3-carboxylate.
| Compound Name | methyl 2-methyl-5-[[[N'-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)carbamimidoyl]amino]methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 111582244 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | methyl 2-methyl-5-[[[N'-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)carbamimidoyl]amino]methyl]furan-3-carboxylate |
| SMILES | C/N=C(/NCc1cc(C(=O)OC)c(C)o1)NCC(C)(C)c1cccs1 |
| InChI | InChI=1S/C18H25N3O3S/c1-12-14(16(22)23-5)9-13(24-12)10-20-17(19-4)21-11-18(2,3)15-7-6-8-25-15/h6-9H,10-11H2,1-5H3,(H2,19,20,21) |
| InChIKey | VKYRKHFTGGIRCV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|