C36H42Cl2N6O2S — CID 11158263
2-[3-[3-[4-(3-chlorophenyl)piperazin-1-yl]propylsulfanyl]-1H-1,2,4-triazol-5-yl]-6,7-dimethoxy-3-methyl-1-(4-propan-2-ylphenyl)isoquinolin-2-ium chloride (PubChem CID 11158263) has the molecular formula C36H42Cl2N6O2S and a molecular weight of 693.75 g/mol. Its IUPAC name is 2-[3-[3-[4-(3-chlorophenyl)piperazin-1-yl]propylsulfanyl]-1H-1,2,4-triazol-5-yl]-6,7-dimethoxy-3-methyl-1-(4-propan-2-ylphenyl)isoquinolin-2-ium chloride.
| Compound Name | 2-[3-[3-[4-(3-chlorophenyl)piperazin-1-yl]propylsulfanyl]-1H-1,2,4-triazol-5-yl]-6,7-dimethoxy-3-methyl-1-(4-propan-2-ylphenyl)isoquinolin-2-ium chloride |
|---|---|
| PubChem CID | 11158263 |
| Molecular Formula | C36H42Cl2N6O2S |
| Molecular Weight | 693.75 g/mol |
| Exact Mass | 692.25 |
| IUPAC Name | 2-[3-[3-[4-(3-chlorophenyl)piperazin-1-yl]propylsulfanyl]-1H-1,2,4-triazol-5-yl]-6,7-dimethoxy-3-methyl-1-(4-propan-2-ylphenyl)isoquinolin-2-ium chloride |
| SMILES | COc1cc2cc(C)[n+](-c3nc(SCCCN4CCN(c5cccc(Cl)c5)CC4)n[nH]3)c(-c3ccc(C(C)C)cc3)c2cc1OC.[Cl-] |
| InChI | InChI=1S/C36H42ClN6O2S.ClH/c1-24(2)26-10-12-27(13-11-26)34-31-23-33(45-5)32(44-4)21-28(31)20-25(3)43(34)35-38-36(40-39-35)46-19-7-14-41-15-17-42(18-16-41)30-9-6-8-29(37)22-30;/h6,8-13,20-24H,7,14-19H2,1-5H3,(H,38,39,40);1H/q+1;/p-1 |
| InChIKey | XJHRNHPDEITMPM-UHFFFAOYSA-M |
| XLogP | 4.31 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.75 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|