C29H29BF2N4O6S3 — CID 11158276
1-difluoroboranyl-2-[(Z)-[5-[(E)-2-[4-[2-oxo-2-[4-[(2-sulfosulfanylacetyl)amino]butylamino]ethoxy]phenyl]ethenyl]pyrrol-2-ylidene]methyl]-5-thiophen-2-ylpyrrole (PubChem CID 11158276) has the molecular formula C29H29BF2N4O6S3 and a molecular weight of 674.58 g/mol. Its IUPAC name is 1-difluoroboranyl-2-[(Z)-[5-[(E)-2-[4-[2-oxo-2-[4-[(2-sulfosulfanylacetyl)amino]butylamino]ethoxy]phenyl]ethenyl]pyrrol-2-ylidene]methyl]-5-thiophen-2-ylpyrrole.
| Compound Name | 1-difluoroboranyl-2-[(Z)-[5-[(E)-2-[4-[2-oxo-2-[4-[(2-sulfosulfanylacetyl)amino]butylamino]ethoxy]phenyl]ethenyl]pyrrol-2-ylidene]methyl]-5-thiophen-2-ylpyrrole |
|---|---|
| PubChem CID | 11158276 |
| Molecular Formula | C29H29BF2N4O6S3 |
| Molecular Weight | 674.58 g/mol |
| Exact Mass | 674.13 |
| IUPAC Name | 1-difluoroboranyl-2-[(Z)-[5-[(E)-2-[4-[2-oxo-2-[4-[(2-sulfosulfanylacetyl)amino]butylamino]ethoxy]phenyl]ethenyl]pyrrol-2-ylidene]methyl]-5-thiophen-2-ylpyrrole |
| SMILES | O=C(COc1ccc(/C=C/C2=N/C(=C\c3ccc(-c4cccs4)n3B(F)F)C=C2)cc1)NCCCCNC(=O)CSS(=O)(=O)O |
| InChI | InChI=1S/C29H29BF2N4O6S3/c31-30(32)36-24(11-14-26(36)27-4-3-17-43-27)18-23-10-9-22(35-23)8-5-21-6-12-25(13-7-21)42-19-28(37)33-15-1-2-16-34-29(38)20-44-45(39,40)41/h3-14,17-18H,1-2,15-16,19-20H2,(H,33,37)(H,34,38)(H,39,40,41)/b8-5+,23-18- |
| InChIKey | GUDVITHYBXJDPM-DOZORJCYSA-N |
| XLogP | 4.98 |
| TPSA | 139.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|