C13H20ClN3O2S — CID 111597052
1-(2-chloroethyl)-N-[(3-hydroxythiolan-3-yl)methyl]-3,5-dimethylpyrazole-4-carboxamide (PubChem CID 111597052) has the molecular formula C13H20ClN3O2S and a molecular weight of 317.84 g/mol. Its IUPAC name is 1-(2-chloroethyl)-N-[(3-hydroxythiolan-3-yl)methyl]-3,5-dimethylpyrazole-4-carboxamide.
| Compound Name | 1-(2-chloroethyl)-N-[(3-hydroxythiolan-3-yl)methyl]-3,5-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 111597052 |
| Molecular Formula | C13H20ClN3O2S |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 1-(2-chloroethyl)-N-[(3-hydroxythiolan-3-yl)methyl]-3,5-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(CCCl)c(C)c1C(=O)NCC1(O)CCSC1 |
| InChI | InChI=1S/C13H20ClN3O2S/c1-9-11(10(2)17(16-9)5-4-14)12(18)15-7-13(19)3-6-20-8-13/h19H,3-8H2,1-2H3,(H,15,18) |
| InChIKey | KCFWYCOUUDQCJM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|