C18H18F3N3O3 — CID 111597562
1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine (PubChem CID 111597562) has the molecular formula C18H18F3N3O3 and a molecular weight of 381.35 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111597562 |
| Molecular Formula | C18H18F3N3O3 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine |
| SMILES | N/C(=N\Cc1ccc(OC(F)(F)F)cc1)NCC1COc2ccccc2O1 |
| InChI | InChI=1S/C18H18F3N3O3/c19-18(20,21)27-13-7-5-12(6-8-13)9-23-17(22)24-10-14-11-25-15-3-1-2-4-16(15)26-14/h1-8,14H,9-11H2,(H3,22,23,24) |
| InChIKey | WOEFMGGPZDSYKK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|