C19H22F4N4O — CID 111597638
1-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine (PubChem CID 111597638) has the molecular formula C19H22F4N4O and a molecular weight of 398.40 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111597638 |
| Molecular Formula | C19H22F4N4O |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 1-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine |
| SMILES | CN(C)C(CN/C(N)=N/Cc1ccc(OC(F)(F)F)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C19H22F4N4O/c1-27(2)17(14-4-3-5-15(20)10-14)12-26-18(24)25-11-13-6-8-16(9-7-13)28-19(21,22)23/h3-10,17H,11-12H2,1-2H3,(H3,24,25,26) |
| InChIKey | IPIYWGHAAYVJQD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|