C17H23F3N6O — CID 111815470
1-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine (PubChem CID 111815470) has the molecular formula C17H23F3N6O and a molecular weight of 384.41 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111815470 |
| Molecular Formula | C17H23F3N6O |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 1-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine |
| SMILES | CN(C)C(CN/C(N)=N/Cc1ccc(OC(F)(F)F)cc1)c1cnn(C)c1 |
| InChI | InChI=1S/C17H23F3N6O/c1-25(2)15(13-9-24-26(3)11-13)10-23-16(21)22-8-12-4-6-14(7-5-12)27-17(18,19)20/h4-7,9,11,15H,8,10H2,1-3H3,(H3,21,22,23) |
| InChIKey | YTAAEZDMIVXNAL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 80.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|