C12H18O3 — CID 11160129
(3'aR,4'S,7'aS)-spiro[1,3-dioxolane-2,1'-2,3,3a,4,5,6,7,7a-octahydroindene]-4'-carbaldehyde (PubChem CID 11160129) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (3'aR,4'S,7'aS)-spiro[1,3-dioxolane-2,1'-2,3,3a,4,5,6,7,7a-octahydroindene]-4'-carbaldehyde.
| Compound Name | (3'aR,4'S,7'aS)-spiro[1,3-dioxolane-2,1'-2,3,3a,4,5,6,7,7a-octahydroindene]-4'-carbaldehyde |
|---|---|
| PubChem CID | 11160129 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (3'aR,4'S,7'aS)-spiro[1,3-dioxolane-2,1'-2,3,3a,4,5,6,7,7a-octahydroindene]-4'-carbaldehyde |
| SMILES | O=C[C@H]1CCC[C@H]2[C@@H]1CCC21OCCO1 |
| InChI | InChI=1S/C12H18O3/c13-8-9-2-1-3-11-10(9)4-5-12(11)14-6-7-15-12/h8-11H,1-7H2/t9-,10-,11+/m1/s1 |
| InChIKey | ZGJPEAQPAFCPOS-MXWKQRLJSA-N |
| XLogP | 1.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|