C14H26O2 — CID 11160488
(1R,2S,3S,5R)-3-[(E,3R)-3-hydroxybut-1-enyl]-2,4,4,5-tetramethylcyclohexan-1-ol (PubChem CID 11160488) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is (1R,2S,3S,5R)-3-[(E,3R)-3-hydroxybut-1-enyl]-2,4,4,5-tetramethylcyclohexan-1-ol.
| Compound Name | (1R,2S,3S,5R)-3-[(E,3R)-3-hydroxybut-1-enyl]-2,4,4,5-tetramethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 11160488 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | (1R,2S,3S,5R)-3-[(E,3R)-3-hydroxybut-1-enyl]-2,4,4,5-tetramethylcyclohexan-1-ol |
| SMILES | C[C@@H]1[C@H](O)C[C@@H](C)C(C)(C)[C@H]1/C=C/[C@@H](C)O |
| InChI | InChI=1S/C14H26O2/c1-9-8-13(16)11(3)12(14(9,4)5)7-6-10(2)15/h6-7,9-13,15-16H,8H2,1-5H3/b7-6+/t9-,10-,11+,12+,13-/m1/s1 |
| InChIKey | OXIQAQSJHWOZCJ-CJOWHVFZSA-N |
| XLogP | 2.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|