C18H29FN4O2 — CID 111607725
N-[2-[[N-ethyl-N'-(2-methoxy-2-methylpropyl)carbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide (PubChem CID 111607725) has the molecular formula C18H29FN4O2 and a molecular weight of 352.45 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-(2-methoxy-2-methylpropyl)carbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide.
| Compound Name | N-[2-[[N-ethyl-N'-(2-methoxy-2-methylpropyl)carbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 111607725 |
| Molecular Formula | C18H29FN4O2 |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | N-[2-[[N-ethyl-N'-(2-methoxy-2-methylpropyl)carbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide |
| SMILES | CCN/C(=N\CC(C)(C)OC)NCCNC(=O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C18H29FN4O2/c1-5-20-17(23-13-18(2,3)25-4)22-10-9-21-16(24)12-14-7-6-8-15(19)11-14/h6-8,11H,5,9-10,12-13H2,1-4H3,(H,21,24)(H2,20,22,23) |
| InChIKey | XBUSVEMEGADLFG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|