C15H24FIN4OS — CID 111609927
N-(4-fluorophenyl)-2-[[N'-methyl-N-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111609927) has the molecular formula C15H24FIN4OS and a molecular weight of 454.35 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[[N'-methyl-N-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-(4-fluorophenyl)-2-[[N'-methyl-N-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111609927 |
| Molecular Formula | C15H24FIN4OS |
| Molecular Weight | 454.35 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | N-(4-fluorophenyl)-2-[[N'-methyl-N-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | C/N=C(/NCC(=O)Nc1ccc(F)cc1)NCC(C)(C)SC.I |
| InChI | InChI=1S/C15H23FN4OS.HI/c1-15(2,22-4)10-19-14(17-3)18-9-13(21)20-12-7-5-11(16)6-8-12;/h5-8H,9-10H2,1-4H3,(H,20,21)(H2,17,18,19);1H |
| InChIKey | QBPOBCKPSMTRSE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|