C21H34IN5O3S — CID 111613184
1-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111613184) has the molecular formula C21H34IN5O3S and a molecular weight of 563.51 g/mol. Its IUPAC name is 1-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111613184 |
| Molecular Formula | C21H34IN5O3S |
| Molecular Weight | 563.51 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | 1-ethyl-2-[[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-[2-(4-methylsulfonylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1c(C)nn(CCOC)c1C)NCCc1ccc(S(C)(=O)=O)cc1.I |
| InChI | InChI=1S/C21H33N5O3S.HI/c1-6-22-21(23-12-11-18-7-9-19(10-8-18)30(5,27)28)24-15-20-16(2)25-26(17(20)3)13-14-29-4;/h7-10H,6,11-15H2,1-5H3,(H2,22,23,24);1H |
| InChIKey | MQCTVRMZSGYVBK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|