C19H24F3N5S — CID 111617942
1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-3-ethyl-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 111617942) has the molecular formula C19H24F3N5S and a molecular weight of 411.50 g/mol. Its IUPAC name is 1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-3-ethyl-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-3-ethyl-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111617942 |
| Molecular Formula | C19H24F3N5S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]-3-ethyl-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1nc(C(F)(F)F)cs1)NCCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C19H24F3N5S/c1-2-23-18(25-11-17-26-16(13-28-17)19(20,21)22)24-8-10-27-9-7-14-5-3-4-6-15(14)12-27/h3-6,13H,2,7-12H2,1H3,(H2,23,24,25) |
| InChIKey | BRBYLVCZFGBZAW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|