C16H26O4Si — CID 11162696
6-[4-[tert-butyl(dimethyl)silyl]-2-hydroxybut-3-ynyl]-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 11162696) has the molecular formula C16H26O4Si and a molecular weight of 310.47 g/mol. Its IUPAC name is 6-[4-[tert-butyl(dimethyl)silyl]-2-hydroxybut-3-ynyl]-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[4-[tert-butyl(dimethyl)silyl]-2-hydroxybut-3-ynyl]-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 11162696 |
| Molecular Formula | C16H26O4Si |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 6-[4-[tert-butyl(dimethyl)silyl]-2-hydroxybut-3-ynyl]-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | CC1(C)OC(=O)C=C(CC(O)C#C[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C16H26O4Si/c1-15(2,3)21(6,7)9-8-12(17)10-13-11-14(18)20-16(4,5)19-13/h11-12,17H,10H2,1-7H3 |
| InChIKey | CAGKGGDEPUGRCV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|