C19H32O5Si — CID 15317843
6-[(E,2S)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethenoxypent-3-enyl]-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 15317843) has the molecular formula C19H32O5Si and a molecular weight of 368.55 g/mol. Its IUPAC name is 6-[(E,2S)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethenoxypent-3-enyl]-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[(E,2S)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethenoxypent-3-enyl]-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 15317843 |
| Molecular Formula | C19H32O5Si |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 6-[(E,2S)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethenoxypent-3-enyl]-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | C=CO[C@H](/C=C/CO[Si](C)(C)C(C)(C)C)CC1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C19H32O5Si/c1-9-21-15(11-10-12-22-25(7,8)18(2,3)4)13-16-14-17(20)24-19(5,6)23-16/h9-11,14-15H,1,12-13H2,2-8H3/b11-10+/t15-/m1/s1 |
| InChIKey | GKVVSYYYGCOLFO-AUECHBEKSA-N |
| XLogP | 4.68 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|