C16H19N3O2 — CID 111630800
1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(1H-indol-2-ylmethyl)urea (PubChem CID 111630800) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(1H-indol-2-ylmethyl)urea.
| Compound Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(1H-indol-2-ylmethyl)urea |
|---|---|
| PubChem CID | 111630800 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(1H-indol-2-ylmethyl)urea |
| SMILES | O=C(NCc1cc2ccccc2[nH]1)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C16H19N3O2/c20-10-11-5-6-13(7-11)19-16(21)17-9-14-8-12-3-1-2-4-15(12)18-14/h1-6,8,11,13,18,20H,7,9-10H2,(H2,17,19,21)/t11-,13+/m0/s1 |
| InChIKey | GTXMDPDTCOXHBN-WCQYABFASA-N |
| XLogP | 1.90 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|