C12H18N4O5S — CID 11163316
[(2S,3S,5R)-3-acetyloxy-5-(6-amino-2-oxo-1,4-dihydro-1,3,5-triazin-3-yl)thiolan-2-yl]methyl acetate (PubChem CID 11163316) has the molecular formula C12H18N4O5S and a molecular weight of 330.37 g/mol. Its IUPAC name is [(2S,3S,5R)-3-acetyloxy-5-(6-amino-2-oxo-1,4-dihydro-1,3,5-triazin-3-yl)thiolan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,5R)-3-acetyloxy-5-(6-amino-2-oxo-1,4-dihydro-1,3,5-triazin-3-yl)thiolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11163316 |
| Molecular Formula | C12H18N4O5S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | [(2S,3S,5R)-3-acetyloxy-5-(6-amino-2-oxo-1,4-dihydro-1,3,5-triazin-3-yl)thiolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1S[C@@H](N2CN=C(N)NC2=O)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C12H18N4O5S/c1-6(17)20-4-9-8(21-7(2)18)3-10(22-9)16-5-14-11(13)15-12(16)19/h8-10H,3-5H2,1-2H3,(H3,13,14,15,19)/t8-,9-,10+/m0/s1 |
| InChIKey | BUBYDZRLVLOVQM-LPEHRKFASA-N |
| XLogP | -0.39 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |