C20H25NO9S — CID 69200276
[(2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-aminophenoxy)thian-2-yl]methyl acetate (PubChem CID 69200276) has the molecular formula C20H25NO9S and a molecular weight of 455.49 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-aminophenoxy)thian-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-aminophenoxy)thian-2-yl]methyl acetate |
|---|---|
| PubChem CID | 69200276 |
| Molecular Formula | C20H25NO9S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | [(2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-aminophenoxy)thian-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1S[C@H](Oc2ccccc2N)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H25NO9S/c1-10(22)26-9-16-17(27-11(2)23)18(28-12(3)24)19(29-13(4)25)20(31-16)30-15-8-6-5-7-14(15)21/h5-8,16-20H,9,21H2,1-4H3/t16-,17+,18-,19+,20-/m0/s1 |
| InChIKey | GXZXGCTZCGSPHK-YHDCXSKOSA-N |
| XLogP | 1.45 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|