C19H28O10S — CID 46204507
[(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-(oxan-2-yloxy)thian-2-yl]methyl acetate (PubChem CID 46204507) has the molecular formula C19H28O10S and a molecular weight of 448.49 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-(oxan-2-yloxy)thian-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-(oxan-2-yloxy)thian-2-yl]methyl acetate |
|---|---|
| PubChem CID | 46204507 |
| Molecular Formula | C19H28O10S |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-(oxan-2-yloxy)thian-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1SC(OC2CCCCO2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H28O10S/c1-10(20)25-9-14-16(26-11(2)21)17(27-12(3)22)18(28-13(4)23)19(30-14)29-15-7-5-6-8-24-15/h14-19H,5-9H2,1-4H3/t14-,15?,16-,17+,18-,19?/m1/s1 |
| InChIKey | RZBSDJGNZNVJDE-QJBNJHTDSA-N |
| XLogP | 1.33 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|