C18H28O7 — CID 22796485
[(1S,2R,3S)-4-acetyloxy-2-(oxan-2-yloxymethyl)-3-(2-oxoethyl)cyclopentyl]methyl acetate (PubChem CID 22796485) has the molecular formula C18H28O7 and a molecular weight of 356.42 g/mol. Its IUPAC name is [(1S,2R,3S)-4-acetyloxy-2-(oxan-2-yloxymethyl)-3-(2-oxoethyl)cyclopentyl]methyl acetate.
| Compound Name | [(1S,2R,3S)-4-acetyloxy-2-(oxan-2-yloxymethyl)-3-(2-oxoethyl)cyclopentyl]methyl acetate |
|---|---|
| PubChem CID | 22796485 |
| Molecular Formula | C18H28O7 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | [(1S,2R,3S)-4-acetyloxy-2-(oxan-2-yloxymethyl)-3-(2-oxoethyl)cyclopentyl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1CC(OC(C)=O)[C@@H](CC=O)[C@@H]1COC1CCCCO1 |
| InChI | InChI=1S/C18H28O7/c1-12(20)23-10-14-9-17(25-13(2)21)15(6-7-19)16(14)11-24-18-5-3-4-8-22-18/h7,14-18H,3-6,8-11H2,1-2H3/t14-,15+,16-,17?,18?/m1/s1 |
| InChIKey | VTCBLJFCSMXMBD-VBWXLCSBSA-N |
| XLogP | 1.87 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|