C23H28O11S — CID 69201805
[(2S,3S,4S,5R,6S)-6-(2-acetyl-3-hydroxy-5-methylphenoxy)-3,4,5-triacetyloxythian-2-yl]methyl acetate (PubChem CID 69201805) has the molecular formula C23H28O11S and a molecular weight of 512.53 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6S)-6-(2-acetyl-3-hydroxy-5-methylphenoxy)-3,4,5-triacetyloxythian-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5R,6S)-6-(2-acetyl-3-hydroxy-5-methylphenoxy)-3,4,5-triacetyloxythian-2-yl]methyl acetate |
|---|---|
| PubChem CID | 69201805 |
| Molecular Formula | C23H28O11S |
| Molecular Weight | 512.53 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | [(2S,3S,4S,5R,6S)-6-(2-acetyl-3-hydroxy-5-methylphenoxy)-3,4,5-triacetyloxythian-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1S[C@H](Oc2cc(C)cc(O)c2C(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H28O11S/c1-10-7-16(29)19(11(2)24)17(8-10)34-23-22(33-15(6)28)21(32-14(5)27)20(31-13(4)26)18(35-23)9-30-12(3)25/h7-8,18,20-23,29H,9H2,1-6H3/t18-,20+,21-,22+,23-/m0/s1 |
| InChIKey | KJLXHSVRPSPWCZ-VTSJOCERSA-N |
| XLogP | 2.08 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.53 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|