C31H36O11S — CID 69199374
methyl 3-[(4-ethylphenyl)methyl]-4-[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)thian-2-yl]oxybenzoate (PubChem CID 69199374) has the molecular formula C31H36O11S and a molecular weight of 616.69 g/mol. Its IUPAC name is methyl 3-[(4-ethylphenyl)methyl]-4-[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)thian-2-yl]oxybenzoate.
| Compound Name | methyl 3-[(4-ethylphenyl)methyl]-4-[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)thian-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 69199374 |
| Molecular Formula | C31H36O11S |
| Molecular Weight | 616.69 g/mol |
| Exact Mass | 616.20 |
| IUPAC Name | methyl 3-[(4-ethylphenyl)methyl]-4-[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)thian-2-yl]oxybenzoate |
| SMILES | CCc1ccc(Cc2cc(C(=O)OC)ccc2O[C@@H]2S[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C31H36O11S/c1-7-21-8-10-22(11-9-21)14-24-15-23(30(36)37-6)12-13-25(24)42-31-29(41-20(5)35)28(40-19(4)34)27(39-18(3)33)26(43-31)16-38-17(2)32/h8-13,15,26-29,31H,7,14,16H2,1-6H3/t26-,27-,28+,29-,31-/m1/s1 |
| InChIKey | FPSHOWVNLMFGEJ-PAVKSNICSA-N |
| XLogP | 3.80 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.69 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|