C28H33BNO9S+ — CID 87737987
CID 87737987 (PubChem CID 87737987) has the molecular formula C28H33BNO9S+ and a molecular weight of 570.45 g/mol.
| Compound Name | CID 87737987 |
|---|---|
| PubChem CID | 87737987 |
| Molecular Formula | C28H33BNO9S+ |
| Molecular Weight | 570.45 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | — |
| SMILES | [B][n+]1ccc(Cc2ccc(CC)cc2)c(O[C@H]2S[C@@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)c1 |
| InChI | InChI=1S/C28H33BNO9S/c1-6-20-7-9-21(10-8-20)13-22-11-12-30(29)14-23(22)39-28-27(38-19(5)34)26(37-18(4)33)25(36-17(3)32)24(40-28)15-35-16(2)31/h7-12,14,24-28H,6,13,15H2,1-5H3/q+1/t24-,25+,26-,27+,28-/m0/s1 |
| InChIKey | SREIBTDPPNAXDP-BIJRFUASSA-N |
| XLogP | 2.24 |
| TPSA | 118.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|