C16H24N2O9S — CID 118371255
[3,4,6-triacetyloxy-5-[(2-aminoacetyl)amino]thian-2-yl]methyl acetate (PubChem CID 118371255) has the molecular formula C16H24N2O9S and a molecular weight of 420.44 g/mol. Its IUPAC name is [3,4,6-triacetyloxy-5-[(2-aminoacetyl)amino]thian-2-yl]methyl acetate.
| Compound Name | [3,4,6-triacetyloxy-5-[(2-aminoacetyl)amino]thian-2-yl]methyl acetate |
|---|---|
| PubChem CID | 118371255 |
| Molecular Formula | C16H24N2O9S |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | [3,4,6-triacetyloxy-5-[(2-aminoacetyl)amino]thian-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1SC(OC(C)=O)C(NC(=O)CN)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C16H24N2O9S/c1-7(19)24-6-11-14(25-8(2)20)15(26-9(3)21)13(18-12(23)5-17)16(28-11)27-10(4)22/h11,13-16H,5-6,17H2,1-4H3,(H,18,23) |
| InChIKey | HHQYJUFRGIGVJT-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 160.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|